C17H19N3O3S — CID 110873996
3,4-dimethyl-N-[4-(2-oxoimidazolidin-1-yl)phenyl]benzenesulfonamide (PubChem CID 110873996) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 3,4-dimethyl-N-[4-(2-oxoimidazolidin-1-yl)phenyl]benzenesulfonamide.
| Compound Name | 3,4-dimethyl-N-[4-(2-oxoimidazolidin-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110873996 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 3,4-dimethyl-N-[4-(2-oxoimidazolidin-1-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(N3CCNC3=O)cc2)cc1C |
| InChI | InChI=1S/C17H19N3O3S/c1-12-3-8-16(11-13(12)2)24(22,23)19-14-4-6-15(7-5-14)20-10-9-18-17(20)21/h3-8,11,19H,9-10H2,1-2H3,(H,18,21) |
| InChIKey | AZEGZKOJISIOLI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |