C17H16ClN3O5S — CID 166190147
5-chloro-2-methyl-3-[[4-(2-oxoimidazolidin-1-yl)phenyl]sulfamoyl]benzoic acid (PubChem CID 166190147) has the molecular formula C17H16ClN3O5S and a molecular weight of 409.85 g/mol. Its IUPAC name is 5-chloro-2-methyl-3-[[4-(2-oxoimidazolidin-1-yl)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 5-chloro-2-methyl-3-[[4-(2-oxoimidazolidin-1-yl)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 166190147 |
| Molecular Formula | C17H16ClN3O5S |
| Molecular Weight | 409.85 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 5-chloro-2-methyl-3-[[4-(2-oxoimidazolidin-1-yl)phenyl]sulfamoyl]benzoic acid |
| SMILES | Cc1c(C(=O)O)cc(Cl)cc1S(=O)(=O)Nc1ccc(N2CCNC2=O)cc1 |
| InChI | InChI=1S/C17H16ClN3O5S/c1-10-14(16(22)23)8-11(18)9-15(10)27(25,26)20-12-2-4-13(5-3-12)21-7-6-19-17(21)24/h2-5,8-9,20H,6-7H2,1H3,(H,19,24)(H,22,23) |
| InChIKey | YWCKSPCKBTVLSL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.85 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |