C12H10ClN3O4S — CID 82874958
5-chloro-2-methyl-3-(pyrimidin-2-ylsulfamoyl)benzoic acid (PubChem CID 82874958) has the molecular formula C12H10ClN3O4S and a molecular weight of 327.75 g/mol. Its IUPAC name is 5-chloro-2-methyl-3-(pyrimidin-2-ylsulfamoyl)benzoic acid.
| Compound Name | 5-chloro-2-methyl-3-(pyrimidin-2-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 82874958 |
| Molecular Formula | C12H10ClN3O4S |
| Molecular Weight | 327.75 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 5-chloro-2-methyl-3-(pyrimidin-2-ylsulfamoyl)benzoic acid |
| SMILES | Cc1c(C(=O)O)cc(Cl)cc1S(=O)(=O)Nc1ncccn1 |
| InChI | InChI=1S/C12H10ClN3O4S/c1-7-9(11(17)18)5-8(13)6-10(7)21(19,20)16-12-14-3-2-4-15-12/h2-6H,1H3,(H,17,18)(H,14,15,16) |
| InChIKey | UFVKNCSEQHVWGR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.75 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |