C12H16ClNO5S — CID 82890604
5-chloro-2-methyl-3-(2-methylpropoxysulfamoyl)benzoic acid (PubChem CID 82890604) has the molecular formula C12H16ClNO5S and a molecular weight of 321.78 g/mol. Its IUPAC name is 5-chloro-2-methyl-3-(2-methylpropoxysulfamoyl)benzoic acid.
| Compound Name | 5-chloro-2-methyl-3-(2-methylpropoxysulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 82890604 |
| Molecular Formula | C12H16ClNO5S |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 5-chloro-2-methyl-3-(2-methylpropoxysulfamoyl)benzoic acid |
| SMILES | Cc1c(C(=O)O)cc(Cl)cc1S(=O)(=O)NOCC(C)C |
| InChI | InChI=1S/C12H16ClNO5S/c1-7(2)6-19-14-20(17,18)11-5-9(13)4-10(8(11)3)12(15)16/h4-5,7,14H,6H2,1-3H3,(H,15,16) |
| InChIKey | REEMMZBDARUTIM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|