C10H15NO5S2 — CID 82706091
3-methyl-5-(2-methylpropoxysulfamoyl)thiophene-2-carboxylic acid (PubChem CID 82706091) has the molecular formula C10H15NO5S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-methyl-5-(2-methylpropoxysulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 3-methyl-5-(2-methylpropoxysulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 82706091 |
| Molecular Formula | C10H15NO5S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 3-methyl-5-(2-methylpropoxysulfamoyl)thiophene-2-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)NOCC(C)C)sc1C(=O)O |
| InChI | InChI=1S/C10H15NO5S2/c1-6(2)5-16-11-18(14,15)8-4-7(3)9(17-8)10(12)13/h4,6,11H,5H2,1-3H3,(H,12,13) |
| InChIKey | ASGWJIBVKQKAMM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|