C13H21NO5S2 — CID 103223773
5-[(1-ethoxy-3-methylbutan-2-yl)sulfamoyl]-3-methylthiophene-2-carboxylic acid (PubChem CID 103223773) has the molecular formula C13H21NO5S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 5-[(1-ethoxy-3-methylbutan-2-yl)sulfamoyl]-3-methylthiophene-2-carboxylic acid.
| Compound Name | 5-[(1-ethoxy-3-methylbutan-2-yl)sulfamoyl]-3-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103223773 |
| Molecular Formula | C13H21NO5S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 5-[(1-ethoxy-3-methylbutan-2-yl)sulfamoyl]-3-methylthiophene-2-carboxylic acid |
| SMILES | CCOCC(NS(=O)(=O)c1cc(C)c(C(=O)O)s1)C(C)C |
| InChI | InChI=1S/C13H21NO5S2/c1-5-19-7-10(8(2)3)14-21(17,18)11-6-9(4)12(20-11)13(15)16/h6,8,10,14H,5,7H2,1-4H3,(H,15,16) |
| InChIKey | HPNVNVJJVYDYCU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |