C12H22N2O3S2 — CID 106093857
4-(aminomethyl)-N-(1-ethoxy-3-methylbutan-2-yl)thiophene-2-sulfonamide (PubChem CID 106093857) has the molecular formula C12H22N2O3S2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(1-ethoxy-3-methylbutan-2-yl)thiophene-2-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-(1-ethoxy-3-methylbutan-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106093857 |
| Molecular Formula | C12H22N2O3S2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 4-(aminomethyl)-N-(1-ethoxy-3-methylbutan-2-yl)thiophene-2-sulfonamide |
| SMILES | CCOCC(NS(=O)(=O)c1cc(CN)cs1)C(C)C |
| InChI | InChI=1S/C12H22N2O3S2/c1-4-17-7-11(9(2)3)14-19(15,16)12-5-10(6-13)8-18-12/h5,8-9,11,14H,4,6-7,13H2,1-3H3 |
| InChIKey | QTIMJHFKBUAYDG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |