C14H23FN2O3S — CID 106093811
2-(aminomethyl)-N-(1-ethoxy-3-methylbutan-2-yl)-5-fluorobenzenesulfonamide (PubChem CID 106093811) has the molecular formula C14H23FN2O3S and a molecular weight of 318.41 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(1-ethoxy-3-methylbutan-2-yl)-5-fluorobenzenesulfonamide.
| Compound Name | 2-(aminomethyl)-N-(1-ethoxy-3-methylbutan-2-yl)-5-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106093811 |
| Molecular Formula | C14H23FN2O3S |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-(aminomethyl)-N-(1-ethoxy-3-methylbutan-2-yl)-5-fluorobenzenesulfonamide |
| SMILES | CCOCC(NS(=O)(=O)c1cc(F)ccc1CN)C(C)C |
| InChI | InChI=1S/C14H23FN2O3S/c1-4-20-9-13(10(2)3)17-21(18,19)14-7-12(15)6-5-11(14)8-16/h5-7,10,13,17H,4,8-9,16H2,1-3H3 |
| InChIKey | QBQKRIWYVJJYGF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |