C13H21FN2O3S — CID 65047751
2-(aminomethyl)-3-fluoro-N-(1-methoxy-3-methylbutan-2-yl)benzenesulfonamide (PubChem CID 65047751) has the molecular formula C13H21FN2O3S and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-(aminomethyl)-3-fluoro-N-(1-methoxy-3-methylbutan-2-yl)benzenesulfonamide.
| Compound Name | 2-(aminomethyl)-3-fluoro-N-(1-methoxy-3-methylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 65047751 |
| Molecular Formula | C13H21FN2O3S |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-(aminomethyl)-3-fluoro-N-(1-methoxy-3-methylbutan-2-yl)benzenesulfonamide |
| SMILES | COCC(NS(=O)(=O)c1cccc(F)c1CN)C(C)C |
| InChI | InChI=1S/C13H21FN2O3S/c1-9(2)12(8-19-3)16-20(17,18)13-6-4-5-11(14)10(13)7-15/h4-6,9,12,16H,7-8,15H2,1-3H3 |
| InChIKey | PWRNWBVWNUEPON-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |