C14H24N2O4S — CID 106068700
4-(2-aminoethoxy)-N-(1-methoxy-3-methylbutan-2-yl)benzenesulfonamide (PubChem CID 106068700) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is 4-(2-aminoethoxy)-N-(1-methoxy-3-methylbutan-2-yl)benzenesulfonamide.
| Compound Name | 4-(2-aminoethoxy)-N-(1-methoxy-3-methylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106068700 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 4-(2-aminoethoxy)-N-(1-methoxy-3-methylbutan-2-yl)benzenesulfonamide |
| SMILES | COCC(NS(=O)(=O)c1ccc(OCCN)cc1)C(C)C |
| InChI | InChI=1S/C14H24N2O4S/c1-11(2)14(10-19-3)16-21(17,18)13-6-4-12(5-7-13)20-9-8-15/h4-7,11,14,16H,8-10,15H2,1-3H3 |
| InChIKey | IYYRDKYJAVKUNO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |