C12H19NO5S — CID 107110952
4-(2-hydroxyethoxy)-N-(1-methoxypropan-2-yl)benzenesulfonamide (PubChem CID 107110952) has the molecular formula C12H19NO5S and a molecular weight of 289.35 g/mol. Its IUPAC name is 4-(2-hydroxyethoxy)-N-(1-methoxypropan-2-yl)benzenesulfonamide.
| Compound Name | 4-(2-hydroxyethoxy)-N-(1-methoxypropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 107110952 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 4-(2-hydroxyethoxy)-N-(1-methoxypropan-2-yl)benzenesulfonamide |
| SMILES | COCC(C)NS(=O)(=O)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C12H19NO5S/c1-10(9-17-2)13-19(15,16)12-5-3-11(4-6-12)18-8-7-14/h3-6,10,13-14H,7-9H2,1-2H3 |
| InChIKey | AENVUASIIOAGMU-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |