C11H17NO4S — CID 884361
4-methoxy-N-[(2R)-1-methoxypropan-2-yl]benzenesulfonamide (PubChem CID 884361) has the molecular formula C11H17NO4S and a molecular weight of 259.33 g/mol. Its IUPAC name is 4-methoxy-N-[(2R)-1-methoxypropan-2-yl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[(2R)-1-methoxypropan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 884361 |
| Molecular Formula | C11H17NO4S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 4-methoxy-N-[(2R)-1-methoxypropan-2-yl]benzenesulfonamide |
| SMILES | COC[C@@H](C)NS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C11H17NO4S/c1-9(8-15-2)12-17(13,14)11-6-4-10(16-3)5-7-11/h4-7,9,12H,8H2,1-3H3/t9-/m1/s1 |
| InChIKey | WVRVCSMQNMXXNH-SECBINFHSA-N |
| XLogP | 1.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |