C12H19NO3S — CID 51183649
4-ethyl-N-(1-methoxypropan-2-yl)benzenesulfonamide (PubChem CID 51183649) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is 4-ethyl-N-(1-methoxypropan-2-yl)benzenesulfonamide.
| Compound Name | 4-ethyl-N-(1-methoxypropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 51183649 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 4-ethyl-N-(1-methoxypropan-2-yl)benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NC(C)COC)cc1 |
| InChI | InChI=1S/C12H19NO3S/c1-4-11-5-7-12(8-6-11)17(14,15)13-10(2)9-16-3/h5-8,10,13H,4,9H2,1-3H3 |
| InChIKey | YWTFQHOYDCAOMS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |