C12H21NO4S2 — CID 106002536
N-(1-ethoxy-3-methylbutan-2-yl)-5-(hydroxymethyl)thiophene-2-sulfonamide (PubChem CID 106002536) has the molecular formula C12H21NO4S2 and a molecular weight of 307.44 g/mol. Its IUPAC name is N-(1-ethoxy-3-methylbutan-2-yl)-5-(hydroxymethyl)thiophene-2-sulfonamide.
| Compound Name | N-(1-ethoxy-3-methylbutan-2-yl)-5-(hydroxymethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106002536 |
| Molecular Formula | C12H21NO4S2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | N-(1-ethoxy-3-methylbutan-2-yl)-5-(hydroxymethyl)thiophene-2-sulfonamide |
| SMILES | CCOCC(NS(=O)(=O)c1ccc(CO)s1)C(C)C |
| InChI | InChI=1S/C12H21NO4S2/c1-4-17-8-11(9(2)3)13-19(15,16)12-6-5-10(7-14)18-12/h5-6,9,11,13-14H,4,7-8H2,1-3H3 |
| InChIKey | GYYBNSXKRMDGCP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |