C11H20N2O2S2 — CID 65192574
N-(1-amino-3-methylbutan-2-yl)-5-ethylthiophene-2-sulfonamide (PubChem CID 65192574) has the molecular formula C11H20N2O2S2 and a molecular weight of 276.43 g/mol. Its IUPAC name is N-(1-amino-3-methylbutan-2-yl)-5-ethylthiophene-2-sulfonamide.
| Compound Name | N-(1-amino-3-methylbutan-2-yl)-5-ethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 65192574 |
| Molecular Formula | C11H20N2O2S2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | N-(1-amino-3-methylbutan-2-yl)-5-ethylthiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NC(CN)C(C)C)s1 |
| InChI | InChI=1S/C11H20N2O2S2/c1-4-9-5-6-11(16-9)17(14,15)13-10(7-12)8(2)3/h5-6,8,10,13H,4,7,12H2,1-3H3 |
| InChIKey | XMGUPPASWHEKQO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |