C9H14BrNO3S2 — CID 22500840
5-bromo-N-(1-hydroxy-3-methylbutan-2-yl)thiophene-2-sulfonamide (PubChem CID 22500840) has the molecular formula C9H14BrNO3S2 and a molecular weight of 328.25 g/mol. Its IUPAC name is 5-bromo-N-(1-hydroxy-3-methylbutan-2-yl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(1-hydroxy-3-methylbutan-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22500840 |
| Molecular Formula | C9H14BrNO3S2 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 326.96 |
| IUPAC Name | 5-bromo-N-(1-hydroxy-3-methylbutan-2-yl)thiophene-2-sulfonamide |
| SMILES | CC(C)C(CO)NS(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C9H14BrNO3S2/c1-6(2)7(5-12)11-16(13,14)9-4-3-8(10)15-9/h3-4,6-7,11-12H,5H2,1-2H3 |
| InChIKey | IFNSHPBRUYSZRW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |