C15H20BrNO4S2 — CID 22500884
5-bromo-N-[3-(furan-2-yl)-1-hydroxy-5-methylhexan-2-yl]thiophene-2-sulfonamide (PubChem CID 22500884) has the molecular formula C15H20BrNO4S2 and a molecular weight of 422.37 g/mol. Its IUPAC name is 5-bromo-N-[3-(furan-2-yl)-1-hydroxy-5-methylhexan-2-yl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[3-(furan-2-yl)-1-hydroxy-5-methylhexan-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22500884 |
| Molecular Formula | C15H20BrNO4S2 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 421.00 |
| IUPAC Name | 5-bromo-N-[3-(furan-2-yl)-1-hydroxy-5-methylhexan-2-yl]thiophene-2-sulfonamide |
| SMILES | CC(C)CC(c1ccco1)C(CO)NS(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C15H20BrNO4S2/c1-10(2)8-11(13-4-3-7-21-13)12(9-18)17-23(19,20)15-6-5-14(16)22-15/h3-7,10-12,17-18H,8-9H2,1-2H3 |
| InChIKey | CUGKCEFQTRVGGZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |