C17H24BrNO4S2 — CID 23001715
5-bromo-N-[3-(furan-2-yl)-1-hydroxynonan-2-yl]thiophene-2-sulfonamide (PubChem CID 23001715) has the molecular formula C17H24BrNO4S2 and a molecular weight of 450.42 g/mol. Its IUPAC name is 5-bromo-N-[3-(furan-2-yl)-1-hydroxynonan-2-yl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[3-(furan-2-yl)-1-hydroxynonan-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 23001715 |
| Molecular Formula | C17H24BrNO4S2 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | 5-bromo-N-[3-(furan-2-yl)-1-hydroxynonan-2-yl]thiophene-2-sulfonamide |
| SMILES | CCCCCCC(c1ccco1)C(CO)NS(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C17H24BrNO4S2/c1-2-3-4-5-7-13(15-8-6-11-23-15)14(12-20)19-25(21,22)17-10-9-16(18)24-17/h6,8-11,13-14,19-20H,2-5,7,12H2,1H3 |
| InChIKey | DSPNZMRHYQXMRJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|