C15H26ClNO3S2 — CID 44571758
5-chloro-N-[(2S,3S)-3-ethyl-1-hydroxynonan-2-yl]thiophene-2-sulfonamide (PubChem CID 44571758) has the molecular formula C15H26ClNO3S2 and a molecular weight of 367.96 g/mol. Its IUPAC name is 5-chloro-N-[(2S,3S)-3-ethyl-1-hydroxynonan-2-yl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(2S,3S)-3-ethyl-1-hydroxynonan-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 44571758 |
| Molecular Formula | C15H26ClNO3S2 |
| Molecular Weight | 367.96 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 5-chloro-N-[(2S,3S)-3-ethyl-1-hydroxynonan-2-yl]thiophene-2-sulfonamide |
| SMILES | CCCCCC[C@H](CC)[C@@H](CO)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H26ClNO3S2/c1-3-5-6-7-8-12(4-2)13(11-18)17-22(19,20)15-10-9-14(16)21-15/h9-10,12-13,17-18H,3-8,11H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | JMUDIKBUGNBIFY-QWHCGFSZSA-N |
| XLogP | 4.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.96 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|