C11H18FNO3S2 — CID 22500717
N-(3-ethyl-1-hydroxypentan-2-yl)-5-fluorothiophene-2-sulfonamide (PubChem CID 22500717) has the molecular formula C11H18FNO3S2 and a molecular weight of 295.40 g/mol. Its IUPAC name is N-(3-ethyl-1-hydroxypentan-2-yl)-5-fluorothiophene-2-sulfonamide.
| Compound Name | N-(3-ethyl-1-hydroxypentan-2-yl)-5-fluorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22500717 |
| Molecular Formula | C11H18FNO3S2 |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | N-(3-ethyl-1-hydroxypentan-2-yl)-5-fluorothiophene-2-sulfonamide |
| SMILES | CCC(CC)C(CO)NS(=O)(=O)c1ccc(F)s1 |
| InChI | InChI=1S/C11H18FNO3S2/c1-3-8(4-2)9(7-14)13-18(15,16)11-6-5-10(12)17-11/h5-6,8-9,13-14H,3-4,7H2,1-2H3 |
| InChIKey | ZHZDPQBRTHZQBL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |