C10H14N2O3S2 — CID 106269433
5-cyano-N-(1-hydroxy-3-methylbutan-2-yl)thiophene-2-sulfonamide (PubChem CID 106269433) has the molecular formula C10H14N2O3S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 5-cyano-N-(1-hydroxy-3-methylbutan-2-yl)thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-(1-hydroxy-3-methylbutan-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106269433 |
| Molecular Formula | C10H14N2O3S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 5-cyano-N-(1-hydroxy-3-methylbutan-2-yl)thiophene-2-sulfonamide |
| SMILES | CC(C)C(CO)NS(=O)(=O)c1ccc(C#N)s1 |
| InChI | InChI=1S/C10H14N2O3S2/c1-7(2)9(6-13)12-17(14,15)10-4-3-8(5-11)16-10/h3-4,7,9,12-13H,6H2,1-2H3 |
| InChIKey | DVNVXJSRUBHUBL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |