C11H18ClNO3S2 — CID 68540037
5-chloro-N-(1-hydroxyheptan-2-yl)thiophene-2-sulfonamide (PubChem CID 68540037) has the molecular formula C11H18ClNO3S2 and a molecular weight of 311.86 g/mol. Its IUPAC name is 5-chloro-N-(1-hydroxyheptan-2-yl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(1-hydroxyheptan-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 68540037 |
| Molecular Formula | C11H18ClNO3S2 |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 5-chloro-N-(1-hydroxyheptan-2-yl)thiophene-2-sulfonamide |
| SMILES | CCCCCC(CO)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H18ClNO3S2/c1-2-3-4-5-9(8-14)13-18(15,16)11-7-6-10(12)17-11/h6-7,9,13-14H,2-5,8H2,1H3 |
| InChIKey | YULKRESWKZTATO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|