C14H16ClNO3S3 — CID 10156475
N-(1-benzylsulfanyl-3-hydroxypropan-2-yl)-5-chlorothiophene-2-sulfonamide (PubChem CID 10156475) has the molecular formula C14H16ClNO3S3 and a molecular weight of 377.94 g/mol. Its IUPAC name is N-(1-benzylsulfanyl-3-hydroxypropan-2-yl)-5-chlorothiophene-2-sulfonamide.
| Compound Name | N-(1-benzylsulfanyl-3-hydroxypropan-2-yl)-5-chlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 10156475 |
| Molecular Formula | C14H16ClNO3S3 |
| Molecular Weight | 377.94 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | N-(1-benzylsulfanyl-3-hydroxypropan-2-yl)-5-chlorothiophene-2-sulfonamide |
| SMILES | O=S(=O)(NC(CO)CSCc1ccccc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H16ClNO3S3/c15-13-6-7-14(21-13)22(18,19)16-12(8-17)10-20-9-11-4-2-1-3-5-11/h1-7,12,16-17H,8-10H2 |
| InChIKey | OMKVQQXWPXSEAY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.94 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |