C18H24ClNO3S2 — CID 66929777
5-chloro-N-[(2S,3S)-1-hydroxy-3-phenyloctan-2-yl]thiophene-2-sulfonamide (PubChem CID 66929777) has the molecular formula C18H24ClNO3S2 and a molecular weight of 401.98 g/mol. Its IUPAC name is 5-chloro-N-[(2S,3S)-1-hydroxy-3-phenyloctan-2-yl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(2S,3S)-1-hydroxy-3-phenyloctan-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 66929777 |
| Molecular Formula | C18H24ClNO3S2 |
| Molecular Weight | 401.98 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 5-chloro-N-[(2S,3S)-1-hydroxy-3-phenyloctan-2-yl]thiophene-2-sulfonamide |
| SMILES | CCCCC[C@@H](c1ccccc1)[C@@H](CO)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H24ClNO3S2/c1-2-3-5-10-15(14-8-6-4-7-9-14)16(13-21)20-25(22,23)18-12-11-17(19)24-18/h4,6-9,11-12,15-16,20-21H,2-3,5,10,13H2,1H3/t15-,16+/m0/s1 |
| InChIKey | RURTYPDLWJYNHM-JKSUJKDBSA-N |
| XLogP | 4.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.98 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|