C9H13Cl2NO3S2 — CID 106158237
5-chloro-N-(4-chloro-1-methoxybutan-2-yl)thiophene-2-sulfonamide (PubChem CID 106158237) has the molecular formula C9H13Cl2NO3S2 and a molecular weight of 318.25 g/mol. Its IUPAC name is 5-chloro-N-(4-chloro-1-methoxybutan-2-yl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(4-chloro-1-methoxybutan-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106158237 |
| Molecular Formula | C9H13Cl2NO3S2 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 5-chloro-N-(4-chloro-1-methoxybutan-2-yl)thiophene-2-sulfonamide |
| SMILES | COCC(CCCl)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C9H13Cl2NO3S2/c1-15-6-7(4-5-10)12-17(13,14)9-3-2-8(11)16-9/h2-3,7,12H,4-6H2,1H3 |
| InChIKey | LPSTZJZWQPHSPA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|