C10H15ClN2O3S2 — CID 78786909
2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-methylpentanamide (PubChem CID 78786909) has the molecular formula C10H15ClN2O3S2 and a molecular weight of 310.83 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-methylpentanamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-methylpentanamide |
|---|---|
| PubChem CID | 78786909 |
| Molecular Formula | C10H15ClN2O3S2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-methylpentanamide |
| SMILES | CCC(C)C(NS(=O)(=O)c1ccc(Cl)s1)C(N)=O |
| InChI | InChI=1S/C10H15ClN2O3S2/c1-3-6(2)9(10(12)14)13-18(15,16)8-5-4-7(11)17-8/h4-6,9,13H,3H2,1-2H3,(H2,12,14) |
| InChIKey | SYYUFYHRRCFXLE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |