C15H24ClNO3S2 — CID 87542796
5-chloro-N-[(E,3S,4S,5R)-5-hydroxy-3-methyldec-7-en-4-yl]thiophene-2-sulfonamide (PubChem CID 87542796) has the molecular formula C15H24ClNO3S2 and a molecular weight of 365.95 g/mol. Its IUPAC name is 5-chloro-N-[(E,3S,4S,5R)-5-hydroxy-3-methyldec-7-en-4-yl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(E,3S,4S,5R)-5-hydroxy-3-methyldec-7-en-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 87542796 |
| Molecular Formula | C15H24ClNO3S2 |
| Molecular Weight | 365.95 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 5-chloro-N-[(E,3S,4S,5R)-5-hydroxy-3-methyldec-7-en-4-yl]thiophene-2-sulfonamide |
| SMILES | CC/C=C/C[C@@H](O)[C@@H](NS(=O)(=O)c1ccc(Cl)s1)[C@@H](C)CC |
| InChI | InChI=1S/C15H24ClNO3S2/c1-4-6-7-8-12(18)15(11(3)5-2)17-22(19,20)14-10-9-13(16)21-14/h6-7,9-12,15,17-18H,4-5,8H2,1-3H3/b7-6+/t11-,12+,15-/m0/s1 |
| InChIKey | LRJWCFVEHKVMLR-WYLANPJESA-N |
| XLogP | 3.81 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.95 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|