C14H22ClNO3S2 — CID 66929976
5-chloro-N-[(E,3S)-5-hydroxy-3,6-dimethyloct-6-en-4-yl]thiophene-2-sulfonamide (PubChem CID 66929976) has the molecular formula C14H22ClNO3S2 and a molecular weight of 351.92 g/mol. Its IUPAC name is 5-chloro-N-[(E,3S)-5-hydroxy-3,6-dimethyloct-6-en-4-yl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(E,3S)-5-hydroxy-3,6-dimethyloct-6-en-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 66929976 |
| Molecular Formula | C14H22ClNO3S2 |
| Molecular Weight | 351.92 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 5-chloro-N-[(E,3S)-5-hydroxy-3,6-dimethyloct-6-en-4-yl]thiophene-2-sulfonamide |
| SMILES | C/C=C(\C)C(O)C(NS(=O)(=O)c1ccc(Cl)s1)[C@@H](C)CC |
| InChI | InChI=1S/C14H22ClNO3S2/c1-5-9(3)13(14(17)10(4)6-2)16-21(18,19)12-8-7-11(15)20-12/h6-9,13-14,16-17H,5H2,1-4H3/b10-6+/t9-,13?,14?/m0/s1 |
| InChIKey | UOWQDWOBRYJTHA-ZEXABIQKSA-N |
| XLogP | 3.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.92 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|