C18H25ClN2O3S2 — CID 66930087
5-chloro-N-[(2S,3S)-1-[4-(dimethylamino)phenyl]-1-hydroxy-3-methylpentan-2-yl]thiophene-2-sulfonamide (PubChem CID 66930087) has the molecular formula C18H25ClN2O3S2 and a molecular weight of 417.00 g/mol. Its IUPAC name is 5-chloro-N-[(2S,3S)-1-[4-(dimethylamino)phenyl]-1-hydroxy-3-methylpentan-2-yl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(2S,3S)-1-[4-(dimethylamino)phenyl]-1-hydroxy-3-methylpentan-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 66930087 |
| Molecular Formula | C18H25ClN2O3S2 |
| Molecular Weight | 417.00 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 5-chloro-N-[(2S,3S)-1-[4-(dimethylamino)phenyl]-1-hydroxy-3-methylpentan-2-yl]thiophene-2-sulfonamide |
| SMILES | CC[C@H](C)[C@H](NS(=O)(=O)c1ccc(Cl)s1)C(O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C18H25ClN2O3S2/c1-5-12(2)17(20-26(23,24)16-11-10-15(19)25-16)18(22)13-6-8-14(9-7-13)21(3)4/h6-12,17-18,20,22H,5H2,1-4H3/t12-,17-,18?/m0/s1 |
| InChIKey | QZRYBNZZIHOWEG-LWNRLHBOSA-N |
| XLogP | 3.89 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.00 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|