C16H22ClN3O2S2 — CID 7497893
5-chloro-N-[(2S)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]thiophene-2-sulfonamide (PubChem CID 7497893) has the molecular formula C16H22ClN3O2S2 and a molecular weight of 387.96 g/mol. Its IUPAC name is 5-chloro-N-[(2S)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(2S)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 7497893 |
| Molecular Formula | C16H22ClN3O2S2 |
| Molecular Weight | 387.96 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 5-chloro-N-[(2S)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]thiophene-2-sulfonamide |
| SMILES | CN(C)c1ccc([C@@H](CNS(=O)(=O)c2ccc(Cl)s2)N(C)C)cc1 |
| InChI | InChI=1S/C16H22ClN3O2S2/c1-19(2)13-7-5-12(6-8-13)14(20(3)4)11-18-24(21,22)16-10-9-15(17)23-16/h5-10,14,18H,11H2,1-4H3/t14-/m1/s1 |
| InChIKey | DBPXMNQTLLXLIW-CQSZACIVSA-N |
| XLogP | 3.05 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.96 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|