C16H21ClN2O2S2 — CID 55353854
5-chloro-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]thiophene-2-sulfonamide (PubChem CID 55353854) has the molecular formula C16H21ClN2O2S2 and a molecular weight of 372.94 g/mol. Its IUPAC name is 5-chloro-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 55353854 |
| Molecular Formula | C16H21ClN2O2S2 |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 5-chloro-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]thiophene-2-sulfonamide |
| SMILES | CCc1ccc(C(CNS(=O)(=O)c2ccc(Cl)s2)N(C)C)cc1 |
| InChI | InChI=1S/C16H21ClN2O2S2/c1-4-12-5-7-13(8-6-12)14(19(2)3)11-18-23(20,21)16-10-9-15(17)22-16/h5-10,14,18H,4,11H2,1-3H3 |
| InChIKey | VCKHRWXSKNWLES-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |