C18H24N2O2S — CID 51169696
N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]benzenesulfonamide (PubChem CID 51169696) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]benzenesulfonamide.
| Compound Name | N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51169696 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]benzenesulfonamide |
| SMILES | CCc1ccc(C(CNS(=O)(=O)c2ccccc2)N(C)C)cc1 |
| InChI | InChI=1S/C18H24N2O2S/c1-4-15-10-12-16(13-11-15)18(20(2)3)14-19-23(21,22)17-8-6-5-7-9-17/h5-13,18-19H,4,14H2,1-3H3 |
| InChIKey | VGEMHZSQIKCTSD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |