C19H22F4N2O3S — CID 18191926
N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-2,3,5,6-tetrafluoro-4-methoxybenzenesulfonamide (PubChem CID 18191926) has the molecular formula C19H22F4N2O3S and a molecular weight of 434.46 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-2,3,5,6-tetrafluoro-4-methoxybenzenesulfonamide.
| Compound Name | N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-2,3,5,6-tetrafluoro-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 18191926 |
| Molecular Formula | C19H22F4N2O3S |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-2,3,5,6-tetrafluoro-4-methoxybenzenesulfonamide |
| SMILES | CCc1ccc(C(CNS(=O)(=O)c2c(F)c(F)c(OC)c(F)c2F)N(C)C)cc1 |
| InChI | InChI=1S/C19H22F4N2O3S/c1-5-11-6-8-12(9-7-11)13(25(2)3)10-24-29(26,27)19-16(22)14(20)18(28-4)15(21)17(19)23/h6-9,13,24H,5,10H2,1-4H3 |
| InChIKey | OICDSMFMTARLNP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|