C18H25N3O4S2 — CID 55512101
3-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]benzene-1,3-disulfonamide (PubChem CID 55512101) has the molecular formula C18H25N3O4S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 3-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]benzene-1,3-disulfonamide.
| Compound Name | 3-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 55512101 |
| Molecular Formula | C18H25N3O4S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 3-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]benzene-1,3-disulfonamide |
| SMILES | CCc1ccc(C(CNS(=O)(=O)c2cccc(S(N)(=O)=O)c2)N(C)C)cc1 |
| InChI | InChI=1S/C18H25N3O4S2/c1-4-14-8-10-15(11-9-14)18(21(2)3)13-20-27(24,25)17-7-5-6-16(12-17)26(19,22)23/h5-12,18,20H,4,13H2,1-3H3,(H2,19,22,23) |
| InChIKey | WPXCEWMTXBKZIO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |