C14H19N3O5S2 — CID 55511765
3-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]benzene-1,3-disulfonamide (PubChem CID 55511765) has the molecular formula C14H19N3O5S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 3-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]benzene-1,3-disulfonamide.
| Compound Name | 3-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 55511765 |
| Molecular Formula | C14H19N3O5S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 3-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]benzene-1,3-disulfonamide |
| SMILES | CN(C)C(CNS(=O)(=O)c1cccc(S(N)(=O)=O)c1)c1ccco1 |
| InChI | InChI=1S/C14H19N3O5S2/c1-17(2)13(14-7-4-8-22-14)10-16-24(20,21)12-6-3-5-11(9-12)23(15,18)19/h3-9,13,16H,10H2,1-2H3,(H2,15,18,19) |
| InChIKey | UCDSJABYHDGJDL-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |