C13H23N3O3S — CID 47149015
N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]piperidine-1-sulfonamide (PubChem CID 47149015) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]piperidine-1-sulfonamide.
| Compound Name | N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 47149015 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]piperidine-1-sulfonamide |
| SMILES | CN(C)C(CNS(=O)(=O)N1CCCCC1)c1ccco1 |
| InChI | InChI=1S/C13H23N3O3S/c1-15(2)12(13-7-6-10-19-13)11-14-20(17,18)16-8-4-3-5-9-16/h6-7,10,12,14H,3-5,8-9,11H2,1-2H3 |
| InChIKey | URHXZHOBSYBWCA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |