C15H19ClN2O3S — CID 93157738
1-(4-chlorophenyl)-N-[(2S)-2-(dimethylamino)-2-(furan-2-yl)ethyl]methanesulfonamide (PubChem CID 93157738) has the molecular formula C15H19ClN2O3S and a molecular weight of 342.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[(2S)-2-(dimethylamino)-2-(furan-2-yl)ethyl]methanesulfonamide.
| Compound Name | 1-(4-chlorophenyl)-N-[(2S)-2-(dimethylamino)-2-(furan-2-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 93157738 |
| Molecular Formula | C15H19ClN2O3S |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[(2S)-2-(dimethylamino)-2-(furan-2-yl)ethyl]methanesulfonamide |
| SMILES | CN(C)[C@@H](CNS(=O)(=O)Cc1ccc(Cl)cc1)c1ccco1 |
| InChI | InChI=1S/C15H19ClN2O3S/c1-18(2)14(15-4-3-9-21-15)10-17-22(19,20)11-12-5-7-13(16)8-6-12/h3-9,14,17H,10-11H2,1-2H3/t14-/m0/s1 |
| InChIKey | XIVCUCFLVXOHQC-AWEZNQCLSA-N |
| XLogP | 2.66 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |