C13H16N2O5S2 — CID 97020376
3-N-[(2R)-1-(furan-2-yl)propan-2-yl]benzene-1,3-disulfonamide (PubChem CID 97020376) has the molecular formula C13H16N2O5S2 and a molecular weight of 344.41 g/mol. Its IUPAC name is 3-N-[(2R)-1-(furan-2-yl)propan-2-yl]benzene-1,3-disulfonamide.
| Compound Name | 3-N-[(2R)-1-(furan-2-yl)propan-2-yl]benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 97020376 |
| Molecular Formula | C13H16N2O5S2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 3-N-[(2R)-1-(furan-2-yl)propan-2-yl]benzene-1,3-disulfonamide |
| SMILES | C[C@H](Cc1ccco1)NS(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H16N2O5S2/c1-10(8-11-4-3-7-20-11)15-22(18,19)13-6-2-5-12(9-13)21(14,16)17/h2-7,9-10,15H,8H2,1H3,(H2,14,16,17)/t10-/m1/s1 |
| InChIKey | LOTPAMQNOJDBKO-SNVBAGLBSA-N |
| XLogP | 0.84 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |