C13H15NO4S — CID 81258780
N-[1-(furan-2-yl)propan-2-yl]-3-hydroxybenzenesulfonamide (PubChem CID 81258780) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is N-[1-(furan-2-yl)propan-2-yl]-3-hydroxybenzenesulfonamide.
| Compound Name | N-[1-(furan-2-yl)propan-2-yl]-3-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 81258780 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N-[1-(furan-2-yl)propan-2-yl]-3-hydroxybenzenesulfonamide |
| SMILES | CC(Cc1ccco1)NS(=O)(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C13H15NO4S/c1-10(8-12-5-3-7-18-12)14-19(16,17)13-6-2-4-11(15)9-13/h2-7,9-10,14-15H,8H2,1H3 |
| InChIKey | SSVVTGPGFFKOJU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |