C10H15NO5S — CID 43708955
3-[1-(furan-2-yl)propan-2-ylsulfamoyl]propanoic acid (PubChem CID 43708955) has the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. Its IUPAC name is 3-[1-(furan-2-yl)propan-2-ylsulfamoyl]propanoic acid.
| Compound Name | 3-[1-(furan-2-yl)propan-2-ylsulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 43708955 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 3-[1-(furan-2-yl)propan-2-ylsulfamoyl]propanoic acid |
| SMILES | CC(Cc1ccco1)NS(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C10H15NO5S/c1-8(7-9-3-2-5-16-9)11-17(14,15)6-4-10(12)13/h2-3,5,8,11H,4,6-7H2,1H3,(H,12,13) |
| InChIKey | ROOWLNCSULWEJB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |