C14H16FNO3S — CID 34161180
1-(4-fluorophenyl)-N-[(2S)-1-(furan-2-yl)propan-2-yl]methanesulfonamide (PubChem CID 34161180) has the molecular formula C14H16FNO3S and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[(2S)-1-(furan-2-yl)propan-2-yl]methanesulfonamide.
| Compound Name | 1-(4-fluorophenyl)-N-[(2S)-1-(furan-2-yl)propan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 34161180 |
| Molecular Formula | C14H16FNO3S |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[(2S)-1-(furan-2-yl)propan-2-yl]methanesulfonamide |
| SMILES | C[C@@H](Cc1ccco1)NS(=O)(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H16FNO3S/c1-11(9-14-3-2-8-19-14)16-20(17,18)10-12-4-6-13(15)7-5-12/h2-8,11,16H,9-10H2,1H3/t11-/m0/s1 |
| InChIKey | LCCZIWNYULCLJK-NSHDSACASA-N |
| XLogP | 2.47 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |