C15H24N2O4 — CID 61471041
7-[1-(furan-2-yl)propan-2-ylcarbamoylamino]heptanoic acid (PubChem CID 61471041) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 7-[1-(furan-2-yl)propan-2-ylcarbamoylamino]heptanoic acid.
| Compound Name | 7-[1-(furan-2-yl)propan-2-ylcarbamoylamino]heptanoic acid |
|---|---|
| PubChem CID | 61471041 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 7-[1-(furan-2-yl)propan-2-ylcarbamoylamino]heptanoic acid |
| SMILES | CC(Cc1ccco1)NC(=O)NCCCCCCC(=O)O |
| InChI | InChI=1S/C15H24N2O4/c1-12(11-13-7-6-10-21-13)17-15(20)16-9-5-3-2-4-8-14(18)19/h6-7,10,12H,2-5,8-9,11H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | GNHGFOOTJOKSNG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|