C12H18N2O4 — CID 61188617
6-(furan-2-ylmethylcarbamoylamino)hexanoic acid (PubChem CID 61188617) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 6-(furan-2-ylmethylcarbamoylamino)hexanoic acid.
| Compound Name | 6-(furan-2-ylmethylcarbamoylamino)hexanoic acid |
|---|---|
| PubChem CID | 61188617 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 6-(furan-2-ylmethylcarbamoylamino)hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)NCc1ccco1 |
| InChI | InChI=1S/C12H18N2O4/c15-11(16)6-2-1-3-7-13-12(17)14-9-10-5-4-8-18-10/h4-5,8H,1-3,6-7,9H2,(H,15,16)(H2,13,14,17) |
| InChIKey | XINXVHRRTOPQKN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|