C11H14N2O6 — CID 61189328
2-(furan-2-ylmethylcarbamoylamino)pentanedioic acid (PubChem CID 61189328) has the molecular formula C11H14N2O6 and a molecular weight of 270.24 g/mol. Its IUPAC name is 2-(furan-2-ylmethylcarbamoylamino)pentanedioic acid.
| Compound Name | 2-(furan-2-ylmethylcarbamoylamino)pentanedioic acid |
|---|---|
| PubChem CID | 61189328 |
| Molecular Formula | C11H14N2O6 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-(furan-2-ylmethylcarbamoylamino)pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)NCc1ccco1)C(=O)O |
| InChI | InChI=1S/C11H14N2O6/c14-9(15)4-3-8(10(16)17)13-11(18)12-6-7-2-1-5-19-7/h1-2,5,8H,3-4,6H2,(H,14,15)(H,16,17)(H2,12,13,18) |
| InChIKey | PRBBOSLFDQWSFU-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |