C13H15FN2O5 — CID 61189681
(2S)-2-[(2-fluorophenyl)methylcarbamoylamino]pentanedioic acid (PubChem CID 61189681) has the molecular formula C13H15FN2O5 and a molecular weight of 298.27 g/mol. Its IUPAC name is (2S)-2-[(2-fluorophenyl)methylcarbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[(2-fluorophenyl)methylcarbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 61189681 |
| Molecular Formula | C13H15FN2O5 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (2S)-2-[(2-fluorophenyl)methylcarbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)NCc1ccccc1F)C(=O)O |
| InChI | InChI=1S/C13H15FN2O5/c14-9-4-2-1-3-8(9)7-15-13(21)16-10(12(19)20)5-6-11(17)18/h1-4,10H,5-7H2,(H,17,18)(H,19,20)(H2,15,16,21)/t10-/m0/s1 |
| InChIKey | BUDHLAWWDIMITH-JTQLQIEISA-N |
| XLogP | 0.94 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |