C12H12FNO6 — CID 107013469
(2S)-2-[(2-fluoro-6-hydroxybenzoyl)amino]pentanedioic acid (PubChem CID 107013469) has the molecular formula C12H12FNO6 and a molecular weight of 285.23 g/mol. Its IUPAC name is (2S)-2-[(2-fluoro-6-hydroxybenzoyl)amino]pentanedioic acid.
| Compound Name | (2S)-2-[(2-fluoro-6-hydroxybenzoyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 107013469 |
| Molecular Formula | C12H12FNO6 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | (2S)-2-[(2-fluoro-6-hydroxybenzoyl)amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)c1c(O)cccc1F)C(=O)O |
| InChI | InChI=1S/C12H12FNO6/c13-6-2-1-3-8(15)10(6)11(18)14-7(12(19)20)4-5-9(16)17/h1-3,7,15H,4-5H2,(H,14,18)(H,16,17)(H,19,20)/t7-/m0/s1 |
| InChIKey | ASQXCSFKGMSJIG-ZETCQYMHSA-N |
| XLogP | 0.58 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |