C12H12FNO5 — CID 61151712
(2S)-2-[(4-fluorobenzoyl)amino]pentanedioic acid (PubChem CID 61151712) has the molecular formula C12H12FNO5 and a molecular weight of 269.23 g/mol. Its IUPAC name is (2S)-2-[(4-fluorobenzoyl)amino]pentanedioic acid.
| Compound Name | (2S)-2-[(4-fluorobenzoyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 61151712 |
| Molecular Formula | C12H12FNO5 |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (2S)-2-[(4-fluorobenzoyl)amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)c1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C12H12FNO5/c13-8-3-1-7(2-4-8)11(17)14-9(12(18)19)5-6-10(15)16/h1-4,9H,5-6H2,(H,14,17)(H,15,16)(H,18,19)/t9-/m0/s1 |
| InChIKey | GFQDLLWTBAMEJV-VIFPVBQESA-N |
| XLogP | 0.87 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |