C16H14FNO6 — CID 40814315
(2R)-2-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]pentanedioic acid (PubChem CID 40814315) has the molecular formula C16H14FNO6 and a molecular weight of 335.29 g/mol. Its IUPAC name is (2R)-2-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]pentanedioic acid.
| Compound Name | (2R)-2-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 40814315 |
| Molecular Formula | C16H14FNO6 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (2R)-2-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@@H](NC(=O)c1ccc(-c2ccc(F)cc2)o1)C(=O)O |
| InChI | InChI=1S/C16H14FNO6/c17-10-3-1-9(2-4-10)12-6-7-13(24-12)15(21)18-11(16(22)23)5-8-14(19)20/h1-4,6-7,11H,5,8H2,(H,18,21)(H,19,20)(H,22,23)/t11-/m1/s1 |
| InChIKey | UJQZZAQUNGFQML-LLVKDONJSA-N |
| XLogP | 2.13 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |