C16H16FNO4 — CID 94317037
(2S)-2-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]-3-methylbutanoic acid (PubChem CID 94317037) has the molecular formula C16H16FNO4 and a molecular weight of 305.31 g/mol. Its IUPAC name is (2S)-2-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 94317037 |
| Molecular Formula | C16H16FNO4 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | (2S)-2-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(-c2ccc(F)cc2)o1)C(=O)O |
| InChI | InChI=1S/C16H16FNO4/c1-9(2)14(16(20)21)18-15(19)13-8-7-12(22-13)10-3-5-11(17)6-4-10/h3-9,14H,1-2H3,(H,18,19)(H,20,21)/t14-/m0/s1 |
| InChIKey | TXZKGWIIZBTEER-AWEZNQCLSA-N |
| XLogP | 2.92 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |