C18H15FN2O2 — CID 51185180
5-(4-fluorophenyl)-N-(1-pyridin-4-ylethyl)furan-2-carboxamide (PubChem CID 51185180) has the molecular formula C18H15FN2O2 and a molecular weight of 310.33 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(1-pyridin-4-ylethyl)furan-2-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-(1-pyridin-4-ylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 51185180 |
| Molecular Formula | C18H15FN2O2 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(1-pyridin-4-ylethyl)furan-2-carboxamide |
| SMILES | CC(NC(=O)c1ccc(-c2ccc(F)cc2)o1)c1ccncc1 |
| InChI | InChI=1S/C18H15FN2O2/c1-12(13-8-10-20-11-9-13)21-18(22)17-7-6-16(23-17)14-2-4-15(19)5-3-14/h2-12H,1H3,(H,21,22) |
| InChIKey | YTMFLXLNDOQNJB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |